About (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate
(Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate (PubChem CID 139062927) has the molecular formula C17H17N3O8
and a molecular weight of 391.34 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate.
Molecular Properties
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate |
| PubChem CID | 139062927 |
| Molecular Formula | C17H17N3O8 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate |
| SMILES | Cc1[nH]cc([N+](=O)[O-])[n+]1CCOC(=O)c1ccccc1.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C13H13N3O4.C4H4O4/c1-10-14-9-12(16(18)19)15(10)7-8-20-13(17)11-5-3-2-4-6-11;5-3(6)1-2-4(7)8/h2-6,9H,7-8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OMIHMGKBJJVLOD-BTJKTKAUSA-N |
| XLogP | -0.25 |
| TPSA | 166.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate?
The IUPAC name of (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate (CID 139062927) is (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate.
What is the SMILES notation for (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate?
The canonical SMILES for (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate is Cc1[nH]cc([N+](=O)[O-])[n+]1CCOC(=O)c1ccccc1.O=C([O-])/C=C\C(=O)O.
What is the InChIKey of (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate?
The InChIKey is OMIHMGKBJJVLOD-BTJKTKAUSA-N. The full InChI is InChI=1S/C13H13N3O4.C4H4O4/c1-10-14-9-12(16(18)19)15(10)7-8-20-13(17)11-5-3-2-4-6-11;5-3(6)1-2-4(7)8/h2-6,9H,7-8H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate?
(Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate has a molecular weight of 391.34 g/mol, XLogP of -0.25, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-hydroxy-4-oxobut-2-enoate;2-(2-methyl-4-nitro-1H-imidazol-3-ium-3-yl)ethyl benzoate is sourced from PubChem (CID 139062927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).