About benzene-1,4-diol;bis(pyridine)
benzene-1,4-diol;bis(pyridine) (PubChem CID 139063023) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is benzene-1,4-diol;bis(pyridine).
Molecular Properties
| Compound Name | benzene-1,4-diol;bis(pyridine) |
| PubChem CID | 139063023 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | benzene-1,4-diol;bis(pyridine) |
| SMILES | Oc1ccc(O)cc1.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C6H6O2.2C5H5N/c7-5-1-2-6(8)4-3-5;2*1-2-4-6-5-3-1/h1-4,7-8H;2*1-5H |
| InChIKey | JKLRZECSVSWEAB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;bis(pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;bis(pyridine)?
The IUPAC name of benzene-1,4-diol;bis(pyridine) (CID 139063023) is benzene-1,4-diol;bis(pyridine).
What is the SMILES notation for benzene-1,4-diol;bis(pyridine)?
The canonical SMILES for benzene-1,4-diol;bis(pyridine) is Oc1ccc(O)cc1.c1ccncc1.c1ccncc1.
What is the InChIKey of benzene-1,4-diol;bis(pyridine)?
The InChIKey is JKLRZECSVSWEAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.2C5H5N/c7-5-1-2-6(8)4-3-5;2*1-2-4-6-5-3-1/h1-4,7-8H;2*1-5H.
What are the key properties of benzene-1,4-diol;bis(pyridine)?
benzene-1,4-diol;bis(pyridine) has a molecular weight of 268.32 g/mol, XLogP of 3.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;bis(pyridine) is sourced from PubChem (CID 139063023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).