About hydron;(2S)-1,2,3-trichloropropane
hydron;(2S)-1,2,3-trichloropropane (PubChem CID 139063099) has the molecular formula C3H5Cl3
and a molecular weight of 147.43 g/mol. Its IUPAC name is hydron;(2S)-1,2,3-trichloropropane.
Molecular Properties
| Compound Name | hydron;(2S)-1,2,3-trichloropropane |
| PubChem CID | 139063099 |
| Molecular Formula | C3H5Cl3 |
| Molecular Weight | 147.43 g/mol |
| Exact Mass | 145.95 |
| IUPAC Name | hydron;(2S)-1,2,3-trichloropropane |
| SMILES | Cl[CH-][C@H](Cl)CCl.[H+] |
| InChI | InChI=1S/C3H4Cl3/c4-1-3(6)2-5/h1,3H,2H2/q-1/p+1/t3-/m0/s1 |
| InChIKey | PXRMJJKXEUSEDC-VKHMYHEASA-O |
| XLogP | 2.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hydron;(2S)-1,2,3-trichloropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;(2S)-1,2,3-trichloropropane?
The IUPAC name of hydron;(2S)-1,2,3-trichloropropane (CID 139063099) is hydron;(2S)-1,2,3-trichloropropane.
What is the SMILES notation for hydron;(2S)-1,2,3-trichloropropane?
The canonical SMILES for hydron;(2S)-1,2,3-trichloropropane is Cl[CH-][C@H](Cl)CCl.[H+].
What is the InChIKey of hydron;(2S)-1,2,3-trichloropropane?
The InChIKey is PXRMJJKXEUSEDC-VKHMYHEASA-O. The full InChI is InChI=1S/C3H4Cl3/c4-1-3(6)2-5/h1,3H,2H2/q-1/p+1/t3-/m0/s1.
What are the key properties of hydron;(2S)-1,2,3-trichloropropane?
hydron;(2S)-1,2,3-trichloropropane has a molecular weight of 147.43 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;(2S)-1,2,3-trichloropropane is sourced from PubChem (CID 139063099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).