C24H23NO5 — CID 139063177
(S)-[(2R,4S,4aR,6R,8aR)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-pyridin-2-ylmethanol (PubChem CID 139063177) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is (S)-[(2R,4S,4aR,6R,8aR)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-pyridin-2-ylmethanol.
| Compound Name | (S)-[(2R,4S,4aR,6R,8aR)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 139063177 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (S)-[(2R,4S,4aR,6R,8aR)-2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-pyridin-2-ylmethanol |
| SMILES | O[C@@H](c1ccccn1)[C@@H]1O[C@H](c2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C24H23NO5/c26-20(18-13-7-8-14-25-18)22-21-19(28-24(30-22)17-11-5-2-6-12-17)15-27-23(29-21)16-9-3-1-4-10-16/h1-14,19-24,26H,15H2/t19-,20+,21-,22+,23-,24-/m1/s1 |
| InChIKey | GCYKKTRLXKLNLO-GUFRKYNFSA-N |
| XLogP | 3.71 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |