About bis(hexanoate);piperazine-1,4-diium
bis(hexanoate);piperazine-1,4-diium (PubChem CID 139063265) has the molecular formula C16H34N2O4
and a molecular weight of 318.46 g/mol. Its IUPAC name is bis(hexanoate);piperazine-1,4-diium.
Molecular Properties
| Compound Name | bis(hexanoate);piperazine-1,4-diium |
| PubChem CID | 139063265 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | bis(hexanoate);piperazine-1,4-diium |
| SMILES | C1C[NH2+]CC[NH2+]1.CCCCCC(=O)[O-].CCCCCC(=O)[O-] |
| InChI | InChI=1S/2C6H12O2.C4H10N2/c2*1-2-3-4-5-6(7)8;1-2-6-4-3-5-1/h2*2-5H2,1H3,(H,7,8);5-6H,1-4H2 |
| InChIKey | TYQCXPLWXOMWKE-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(hexanoate);piperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hexanoate);piperazine-1,4-diium?
The IUPAC name of bis(hexanoate);piperazine-1,4-diium (CID 139063265) is bis(hexanoate);piperazine-1,4-diium.
What is the SMILES notation for bis(hexanoate);piperazine-1,4-diium?
The canonical SMILES for bis(hexanoate);piperazine-1,4-diium is C1C[NH2+]CC[NH2+]1.CCCCCC(=O)[O-].CCCCCC(=O)[O-].
What is the InChIKey of bis(hexanoate);piperazine-1,4-diium?
The InChIKey is TYQCXPLWXOMWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O2.C4H10N2/c2*1-2-3-4-5-6(7)8;1-2-6-4-3-5-1/h2*2-5H2,1H3,(H,7,8);5-6H,1-4H2.
What are the key properties of bis(hexanoate);piperazine-1,4-diium?
bis(hexanoate);piperazine-1,4-diium has a molecular weight of 318.46 g/mol, XLogP of -2.24, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hexanoate);piperazine-1,4-diium is sourced from PubChem (CID 139063265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).