C16H34N2O4 — CID 139063266
piperazine-1,4-diium;bis(2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate) (PubChem CID 139063266) has the molecular formula C16H34N2O4 and a molecular weight of 340.59 g/mol. Its IUPAC name is piperazine-1,4-diium;bis(2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate).
| Compound Name | piperazine-1,4-diium;bis(2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate) |
|---|---|
| PubChem CID | 139063266 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.39 |
| IUPAC Name | piperazine-1,4-diium;bis(2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate) |
| SMILES | C1C[NH2+]CC[NH2+]1.[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-] |
| InChI | InChI=1S/2C6H12O2.C4H10N2/c2*1-2-3-4-5-6(7)8;1-2-6-4-3-5-1/h2*2-5H2,1H3,(H,7,8);5-6H,1-4H2/i2*1D3,2D2,3D2,4D2,5D2; |
| InChIKey | TYQCXPLWXOMWKE-HCOHHTAVSA-N |
| XLogP | -2.24 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |