C33H36O9 — CID 139063555
2,4-bis(2-ethoxyphenyl)cyclobutane-1,3-dicarboxylic acid;(E)-3-(2-ethoxyphenyl)prop-2-enoic acid (PubChem CID 139063555) has the molecular formula C33H36O9 and a molecular weight of 576.64 g/mol. Its IUPAC name is 2,4-bis(2-ethoxyphenyl)cyclobutane-1,3-dicarboxylic acid;(E)-3-(2-ethoxyphenyl)prop-2-enoic acid.
| Compound Name | 2,4-bis(2-ethoxyphenyl)cyclobutane-1,3-dicarboxylic acid;(E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 139063555 |
| Molecular Formula | C33H36O9 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2,4-bis(2-ethoxyphenyl)cyclobutane-1,3-dicarboxylic acid;(E)-3-(2-ethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1ccccc1/C=C/C(=O)O.CCOc1ccccc1[C@H]1[C@@H](C(=O)O)[C@@H](c2ccccc2OCC)[C@H]1C(=O)O |
| InChI | InChI=1S/C22H24O6.C11H12O3/c1-3-27-15-11-7-5-9-13(15)17-19(21(23)24)18(20(17)22(25)26)14-10-6-8-12-16(14)28-4-2;1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h5-12,17-20H,3-4H2,1-2H3,(H,23,24)(H,25,26);3-8H,2H2,1H3,(H,12,13)/b;8-7+/t17-,18+,19+,20-; |
| InChIKey | KOWJJOONKCKVAY-JHGJVPLBSA-N |
| XLogP | 5.95 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|