About (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine
(2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine (PubChem CID 139063650) has the molecular formula C16H16N2O5
and a molecular weight of 316.31 g/mol. Its IUPAC name is (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine.
Molecular Properties
| Compound Name | (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine |
| PubChem CID | 139063650 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine |
| SMILES | C(=C/c1cc[nH+]cc1)\c1ccncc1.O=C(O)C[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C12H10N2.C4H6O5/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;5-2(4(8)9)1-3(6)7/h1-10H;2,5H,1H2,(H,6,7)(H,8,9)/b2-1+;/t;2-/m.0/s1 |
| InChIKey | XSBPREYTTZQWGX-DXYBBOSGSA-N |
| XLogP | -0.36 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine?
The IUPAC name of (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine (CID 139063650) is (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine.
What is the SMILES notation for (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine?
The canonical SMILES for (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine is C(=C/c1cc[nH+]cc1)\c1ccncc1.O=C(O)C[C@H](O)C(=O)[O-].
What is the InChIKey of (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine?
The InChIKey is XSBPREYTTZQWGX-DXYBBOSGSA-N. The full InChI is InChI=1S/C12H10N2.C4H6O5/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;5-2(4(8)9)1-3(6)7/h1-10H;2,5H,1H2,(H,6,7)(H,8,9)/b2-1+;/t;2-/m.0/s1.
What are the key properties of (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine?
(2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine has a molecular weight of 316.31 g/mol, XLogP of -0.36, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dihydroxy-4-oxobutanoate;4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridine is sourced from PubChem (CID 139063650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).