About 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol
3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol (PubChem CID 139063676) has the molecular formula C26H31NO2
and a molecular weight of 389.54 g/mol. Its IUPAC name is 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol.
Molecular Properties
| Compound Name | 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol |
| PubChem CID | 139063676 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol |
| SMILES | Cc1cc(C)cc(N)c1.Oc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C18H20O2.C8H11N/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;1-6-3-7(2)5-8(9)4-6/h4-11,19-20H,1-3,12-13H2;3-5H,9H2,1-2H3 |
| InChIKey | KYZNPVQUECGDQM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol?
The IUPAC name of 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol (CID 139063676) is 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol.
What is the SMILES notation for 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol?
The canonical SMILES for 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol is Cc1cc(C)cc(N)c1.Oc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1.
What is the InChIKey of 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol?
The InChIKey is KYZNPVQUECGDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2.C8H11N/c19-16-8-4-14(5-9-16)18(12-2-1-3-13-18)15-6-10-17(20)11-7-15;1-6-3-7(2)5-8(9)4-6/h4-11,19-20H,1-3,12-13H2;3-5H,9H2,1-2H3.
What are the key properties of 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol?
3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol has a molecular weight of 389.54 g/mol, XLogP of 6.23, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylaniline;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol is sourced from PubChem (CID 139063676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).