About bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium
bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium (PubChem CID 139063752) has the molecular formula C26H18N6O12
and a molecular weight of 606.46 g/mol. Its IUPAC name is bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium.
Molecular Properties
| Compound Name | bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium |
| PubChem CID | 139063752 |
| Molecular Formula | C26H18N6O12 |
| Molecular Weight | 606.46 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium |
| SMILES | C(=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.O=C([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.O=C([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N2.2C7H4N2O6/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-10H;2*1-3H,(H,10,11)/b2-1+;; |
| InChIKey | ZGFWHXFRZITEIA-SEPHDYHBSA-N |
| XLogP | 1.22 |
| TPSA | 281.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
The IUPAC name of bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium (CID 139063752) is bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium.
What is the SMILES notation for bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
The canonical SMILES for bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium is C(=C/c1cc[nH+]cc1)\c1cc[nH+]cc1.O=C([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.O=C([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.
What is the InChIKey of bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
The InChIKey is ZGFWHXFRZITEIA-SEPHDYHBSA-N. The full InChI is InChI=1S/C12H10N2.2C7H4N2O6/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-10H;2*1-3H,(H,10,11)/b2-1+;;.
What are the key properties of bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium?
bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium has a molecular weight of 606.46 g/mol, XLogP of 1.22, 8 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-dinitrobenzoate);4-[(E)-2-pyridin-1-ium-4-ylethenyl]pyridin-1-ium is sourced from PubChem (CID 139063752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).