C20H21N3O4S2 — CID 139063783
bis(acetonitrile);13λ6,15λ6-dithia-14-azatetracyclo[8.7.2.04,16.07,12]nonadeca-1(17),2,4(16),7(12),8,10-hexaene 13,13,15,15-tetraoxide (PubChem CID 139063783) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is bis(acetonitrile);13λ6,15λ6-dithia-14-azatetracyclo[8.7.2.04,16.07,12]nonadeca-1(17),2,4(16),7(12),8,10-hexaene 13,13,15,15-tetraoxide.
| Compound Name | bis(acetonitrile);13λ6,15λ6-dithia-14-azatetracyclo[8.7.2.04,16.07,12]nonadeca-1(17),2,4(16),7(12),8,10-hexaene 13,13,15,15-tetraoxide |
|---|---|
| PubChem CID | 139063783 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | bis(acetonitrile);13λ6,15λ6-dithia-14-azatetracyclo[8.7.2.04,16.07,12]nonadeca-1(17),2,4(16),7(12),8,10-hexaene 13,13,15,15-tetraoxide |
| SMILES | CC#N.CC#N.O=S1(=O)NS(=O)(=O)c2cc3ccc2CCc2ccc(cc21)CC3 |
| InChI | InChI=1S/C16H15NO4S2.2C2H3N/c18-22(19)15-9-11-1-2-12-4-6-14(8-7-13(15)5-3-11)16(10-12)23(20,21)17-22;2*1-2-3/h3-6,9-10,17H,1-2,7-8H2;2*1H3 |
| InChIKey | XCMLSWSJMFDRCR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |