C19H30N3O2P — CID 139063947
N-bis(4-methylpiperidin-1-yl)phosphorylbenzamide (PubChem CID 139063947) has the molecular formula C19H30N3O2P and a molecular weight of 363.44 g/mol. Its IUPAC name is N-bis(4-methylpiperidin-1-yl)phosphorylbenzamide.
| Compound Name | N-bis(4-methylpiperidin-1-yl)phosphorylbenzamide |
|---|---|
| PubChem CID | 139063947 |
| Molecular Formula | C19H30N3O2P |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-bis(4-methylpiperidin-1-yl)phosphorylbenzamide |
| SMILES | CC1CCN(P(=O)(NC(=O)c2ccccc2)N2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C19H30N3O2P/c1-16-8-12-21(13-9-16)25(24,22-14-10-17(2)11-15-22)20-19(23)18-6-4-3-5-7-18/h3-7,16-17H,8-15H2,1-2H3,(H,20,23,24) |
| InChIKey | CALGPZVCQYZKLL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|