About 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium
3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium (PubChem CID 139064102) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium.
Molecular Properties
| Compound Name | 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium |
| PubChem CID | 139064102 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium |
| SMILES | O=C(O)c1cccc([O-])c1.[NH3+]CCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO.C7H6O3/c9-6-5-7-1-3-8(10)4-2-7;8-6-3-1-2-5(4-6)7(9)10/h1-4,10H,5-6,9H2;1-4,8H,(H,9,10) |
| InChIKey | UOIZGSIJMIUPTH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium?
The IUPAC name of 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium (CID 139064102) is 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium.
What is the SMILES notation for 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium?
The canonical SMILES for 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium is O=C(O)c1cccc([O-])c1.[NH3+]CCc1ccc(O)cc1.
What is the InChIKey of 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium?
The InChIKey is UOIZGSIJMIUPTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H6O3/c9-6-5-7-1-3-8(10)4-2-7;8-6-3-1-2-5(4-6)7(9)10/h1-4,10H,5-6,9H2;1-4,8H,(H,9,10).
What are the key properties of 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium?
3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium has a molecular weight of 275.30 g/mol, XLogP of 0.63, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxyphenolate;2-(4-hydroxyphenyl)ethylazanium is sourced from PubChem (CID 139064102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).