About 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate
2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate (PubChem CID 139064108) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate |
| PubChem CID | 139064108 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1.[NH3+]CCc1ccc(O)cc1 |
| InChI | InChI=1S/C8H11NO.C8H8O2/c9-6-5-7-1-3-8(10)4-2-7;1-6-2-4-7(5-3-6)8(9)10/h1-4,10H,5-6,9H2;2-5H,1H3,(H,9,10) |
| InChIKey | ROACOINXFKMGDK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate?
The IUPAC name of 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate (CID 139064108) is 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate.
What is the SMILES notation for 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate?
The canonical SMILES for 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate is Cc1ccc(C(=O)[O-])cc1.[NH3+]CCc1ccc(O)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate?
The InChIKey is ROACOINXFKMGDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C8H8O2/c9-6-5-7-1-3-8(10)4-2-7;1-6-2-4-7(5-3-6)8(9)10/h1-4,10H,5-6,9H2;2-5H,1H3,(H,9,10).
What are the key properties of 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate?
2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate has a molecular weight of 273.33 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)ethylazanium;4-methylbenzoate is sourced from PubChem (CID 139064108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).