About bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol
bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol (PubChem CID 139064168) has the molecular formula C24H34N4O2
and a molecular weight of 410.56 g/mol. Its IUPAC name is bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol.
Molecular Properties
| Compound Name | bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol |
| PubChem CID | 139064168 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol |
| SMILES | C1CN2CCN1CC2.C1CN2CCN1CC2.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H10O2.2C6H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;2*1-2-8-5-3-7(1)4-6-8/h1-8,13-14H;2*1-6H2 |
| InChIKey | REMKOGUSEULZMF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol?
The IUPAC name of bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol (CID 139064168) is bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol.
What is the SMILES notation for bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol?
The canonical SMILES for bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol is C1CN2CCN1CC2.C1CN2CCN1CC2.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol?
The InChIKey is REMKOGUSEULZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.2C6H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;2*1-2-8-5-3-7(1)4-6-8/h1-8,13-14H;2*1-6H2.
What are the key properties of bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol?
bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol has a molecular weight of 410.56 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,4-diazabicyclo[2.2.2]octane);4-(4-hydroxyphenyl)phenol is sourced from PubChem (CID 139064168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).