About benzene-1,3,5-triol;bis(4-phenylpyridine)
benzene-1,3,5-triol;bis(4-phenylpyridine) (PubChem CID 139064569) has the molecular formula C28H24N2O3
and a molecular weight of 436.51 g/mol. Its IUPAC name is benzene-1,3,5-triol;bis(4-phenylpyridine).
Molecular Properties
| Compound Name | benzene-1,3,5-triol;bis(4-phenylpyridine) |
| PubChem CID | 139064569 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | benzene-1,3,5-triol;bis(4-phenylpyridine) |
| SMILES | Oc1cc(O)cc(O)c1.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/2C11H9N.C6H6O3/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;7-4-1-5(8)3-6(9)2-4/h2*1-9H;1-3,7-9H |
| InChIKey | DSXASTKESVHVKY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzene-1,3,5-triol;bis(4-phenylpyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3,5-triol;bis(4-phenylpyridine)?
The IUPAC name of benzene-1,3,5-triol;bis(4-phenylpyridine) (CID 139064569) is benzene-1,3,5-triol;bis(4-phenylpyridine).
What is the SMILES notation for benzene-1,3,5-triol;bis(4-phenylpyridine)?
The canonical SMILES for benzene-1,3,5-triol;bis(4-phenylpyridine) is Oc1cc(O)cc(O)c1.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1.
What is the InChIKey of benzene-1,3,5-triol;bis(4-phenylpyridine)?
The InChIKey is DSXASTKESVHVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H9N.C6H6O3/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;7-4-1-5(8)3-6(9)2-4/h2*1-9H;1-3,7-9H.
What are the key properties of benzene-1,3,5-triol;bis(4-phenylpyridine)?
benzene-1,3,5-triol;bis(4-phenylpyridine) has a molecular weight of 436.51 g/mol, XLogP of 6.30, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3,5-triol;bis(4-phenylpyridine) is sourced from PubChem (CID 139064569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).