C19H32O2Si — CID 139064822
trans-(2R,3S)-2-[(1S,3aS,5S,6aR)-1-hydroxy-5-trimethylsilyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-prop-2-enylcyclopentan-1-one (PubChem CID 139064822) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is trans-(2R,3S)-2-[(1S,3aS,5S,6aR)-1-hydroxy-5-trimethylsilyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-prop-2-enylcyclopentan-1-one.
| Compound Name | trans-(2R,3S)-2-[(1S,3aS,5S,6aR)-1-hydroxy-5-trimethylsilyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-prop-2-enylcyclopentan-1-one |
|---|---|
| PubChem CID | 139064822 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | trans-(2R,3S)-2-[(1S,3aS,5S,6aR)-1-hydroxy-5-trimethylsilyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl]-3-prop-2-enylcyclopentan-1-one |
| SMILES | C=CC[C@@H]1CCC(=O)[C@H]1[C@]1(O)CC[C@H]2C[C@H]([Si](C)(C)C)C[C@H]21 |
| InChI | InChI=1S/C19H32O2Si/c1-5-6-13-7-8-17(20)18(13)19(21)10-9-14-11-15(12-16(14)19)22(2,3)4/h5,13-16,18,21H,1,6-12H2,2-4H3/t13-,14+,15+,16-,18+,19+/m1/s1 |
| InChIKey | KNCCNHAZFRSKKG-NBBHSKLNSA-N |
| XLogP | 4.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|