C24H46N6 — CID 139064861
3-[(3S,5S,10R,12R)-8-(2-cyanoethyl)-3,5,7,7,10,12,14,14-octamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile (PubChem CID 139064861) has the molecular formula C24H46N6 and a molecular weight of 418.67 g/mol. Its IUPAC name is 3-[(3S,5S,10R,12R)-8-(2-cyanoethyl)-3,5,7,7,10,12,14,14-octamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile.
| Compound Name | 3-[(3S,5S,10R,12R)-8-(2-cyanoethyl)-3,5,7,7,10,12,14,14-octamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile |
|---|---|
| PubChem CID | 139064861 |
| Molecular Formula | C24H46N6 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.38 |
| IUPAC Name | 3-[(3S,5S,10R,12R)-8-(2-cyanoethyl)-3,5,7,7,10,12,14,14-octamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile |
| SMILES | C[C@@H]1CN(CCC#N)C(C)(C)C[C@H](C)N[C@@H](C)CN(CCC#N)C(C)(C)C[C@@H](C)N1 |
| InChI | InChI=1S/C24H46N6/c1-19-15-23(5,6)29(13-9-11-25)18-22(4)28-20(2)16-24(7,8)30(14-10-12-26)17-21(3)27-19/h19-22,27-28H,9-10,13-18H2,1-8H3/t19-,20+,21-,22+ |
| InChIKey | SDZASDNGHMZDCL-COPRSSIGSA-N |
| XLogP | 3.50 |
| TPSA | 78.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |