C16H20N4O6 — CID 139064880
3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(pyridin-1-ium-4-amine);dihydrate (PubChem CID 139064880) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is 3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(pyridin-1-ium-4-amine);dihydrate.
| Compound Name | 3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(pyridin-1-ium-4-amine);dihydrate |
|---|---|
| PubChem CID | 139064880 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3,6-dioxocyclohexa-1,4-diene-1,4-diolate;bis(pyridin-1-ium-4-amine);dihydrate |
| SMILES | Nc1cc[nH+]cc1.Nc1cc[nH+]cc1.O.O.O=C1C=C([O-])C(=O)C=C1[O-] |
| InChI | InChI=1S/C6H4O4.2C5H6N2.2H2O/c7-3-1-4(8)6(10)2-5(3)9;2*6-5-1-3-7-4-2-5;;/h1-2,7,10H;2*1-4H,(H2,6,7);2*1H2 |
| InChIKey | HPKDJHYUQHHNFC-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 223.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|