About (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide
(3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide (PubChem CID 139065050) has the molecular formula C15H31IN2O
and a molecular weight of 382.33 g/mol. Its IUPAC name is (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide.
Molecular Properties
| Compound Name | (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide |
| PubChem CID | 139065050 |
| Molecular Formula | C15H31IN2O |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide |
| SMILES | C=C1CN(C(C)(C)C)C[C@H](O)C[NH+](C(C)(C)C)C1.[I-] |
| InChI | InChI=1S/C15H30N2O.HI/c1-12-8-16(14(2,3)4)10-13(18)11-17(9-12)15(5,6)7;/h13,18H,1,8-11H2,2-7H3;1H |
| InChIKey | ISEMFGYUZNPYAF-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide?
The IUPAC name of (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide (CID 139065050) is (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide.
What is the SMILES notation for (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide?
The canonical SMILES for (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide is C=C1CN(C(C)(C)C)C[C@H](O)C[NH+](C(C)(C)C)C1.[I-].
What is the InChIKey of (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide?
The InChIKey is ISEMFGYUZNPYAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O.HI/c1-12-8-16(14(2,3)4)10-13(18)11-17(9-12)15(5,6)7;/h13,18H,1,8-11H2,2-7H3;1H.
What are the key properties of (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide?
(3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide has a molecular weight of 382.33 g/mol, XLogP of -2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,5-ditert-butyl-7-methylidene-1,5-diazocan-1-ium-3-ol iodide is sourced from PubChem (CID 139065050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).