C20H30O9S — CID 139065150
[(2R,3R,4aS,5S,7R,8R,8aR)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-methylbenzenesulfonate (PubChem CID 139065150) has the molecular formula C20H30O9S and a molecular weight of 446.52 g/mol. Its IUPAC name is [(2R,3R,4aS,5S,7R,8R,8aR)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4aS,5S,7R,8R,8aR)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139065150 |
| Molecular Formula | C20H30O9S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [(2R,3R,4aS,5S,7R,8R,8aR)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2[C@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H30O9S/c1-12-8-10-14(11-9-12)30(21,22)29-17-16-15(13(2)26-18(17)23-5)27-19(3,24-6)20(4,25-7)28-16/h8-11,13,15-18H,1-7H3/t13-,15-,16+,17+,18+,19+,20+/m0/s1 |
| InChIKey | VMYMYPBJZIAYDK-UNVHRYENSA-N |
| XLogP | 1.97 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|