C50H58N2O4 — CID 139065402
(8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-(pyridin-2-ylmethylidene)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 139065402) has the molecular formula C50H58N2O4 and a molecular weight of 751.02 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-(pyridin-2-ylmethylidene)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-(pyridin-2-ylmethylidene)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 139065402 |
| Molecular Formula | C50H58N2O4 |
| Molecular Weight | 751.02 g/mol |
| Exact Mass | 750.44 |
| IUPAC Name | (8R,9S,10R,13S,14S,16E)-10,13-dimethyl-16-(pyridin-2-ylmethylidene)-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C/c3ccccn3)C[C@@H]12.C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)/C(=C/c3ccccn3)C[C@@H]12 |
| InChI | InChI=1S/2C25H29NO2/c2*1-24-10-8-19(27)15-17(24)6-7-20-21(24)9-11-25(2)22(20)14-16(23(25)28)13-18-5-3-4-12-26-18/h2*3-5,12-13,15,20-22H,6-11,14H2,1-2H3/b2*16-13+/t2*20-,21+,22+,24+,25+/m11/s1 |
| InChIKey | PPVVJZFXGCRQIV-CEWUGLFRSA-N |
| XLogP | 10.35 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.02 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|