About lithium;diphenylphosphinate;oxolane
lithium;diphenylphosphinate;oxolane (PubChem CID 139065490) has the molecular formula C16H18LiO3P
and a molecular weight of 296.23 g/mol. Its IUPAC name is lithium;diphenylphosphinate;oxolane.
Molecular Properties
| Compound Name | lithium;diphenylphosphinate;oxolane |
| PubChem CID | 139065490 |
| Molecular Formula | C16H18LiO3P |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | lithium;diphenylphosphinate;oxolane |
| SMILES | C1CCOC1.O=P([O-])(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C12H11O2P.C4H8O.Li/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-4-5-3-1;/h1-10H,(H,13,14);1-4H2;/q;;+1/p-1 |
| InChIKey | UBMTXOROLRTWKS-UHFFFAOYSA-M |
| XLogP | -0.92 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;diphenylphosphinate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;diphenylphosphinate;oxolane?
The IUPAC name of lithium;diphenylphosphinate;oxolane (CID 139065490) is lithium;diphenylphosphinate;oxolane.
What is the SMILES notation for lithium;diphenylphosphinate;oxolane?
The canonical SMILES for lithium;diphenylphosphinate;oxolane is C1CCOC1.O=P([O-])(c1ccccc1)c1ccccc1.[Li+].
What is the InChIKey of lithium;diphenylphosphinate;oxolane?
The InChIKey is UBMTXOROLRTWKS-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H11O2P.C4H8O.Li/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-4-5-3-1;/h1-10H,(H,13,14);1-4H2;/q;;+1/p-1.
What are the key properties of lithium;diphenylphosphinate;oxolane?
lithium;diphenylphosphinate;oxolane has a molecular weight of 296.23 g/mol, XLogP of -0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;diphenylphosphinate;oxolane is sourced from PubChem (CID 139065490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).