About 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride
4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride (PubChem CID 139065608) has the molecular formula C6H8Cl2N4S2
and a molecular weight of 271.20 g/mol. Its IUPAC name is 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride.
Molecular Properties
| Compound Name | 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride |
| PubChem CID | 139065608 |
| Molecular Formula | C6H8Cl2N4S2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride |
| SMILES | Nc1[nH+]c(-c2csc(N)[nH+]2)cs1.[Cl-].[Cl-] |
| InChI | InChI=1S/C6H6N4S2.2ClH/c7-5-9-3(1-11-5)4-2-12-6(8)10-4;;/h1-2H,(H2,7,9)(H2,8,10);2*1H |
| InChIKey | WAMKWGVBHWRLKL-UHFFFAOYSA-N |
| XLogP | -5.72 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | -5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride?
The IUPAC name of 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride (CID 139065608) is 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride.
What is the SMILES notation for 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride?
The canonical SMILES for 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride is Nc1[nH+]c(-c2csc(N)[nH+]2)cs1.[Cl-].[Cl-].
What is the InChIKey of 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride?
The InChIKey is WAMKWGVBHWRLKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S2.2ClH/c7-5-9-3(1-11-5)4-2-12-6(8)10-4;;/h1-2H,(H2,7,9)(H2,8,10);2*1H.
What are the key properties of 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride?
4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride has a molecular weight of 271.20 g/mol, XLogP of -5.72, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,3-thiazol-3-ium-4-yl)-1,3-thiazol-3-ium-2-amine dichloride is sourced from PubChem (CID 139065608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).