C22H26N2 — CID 139065652
(2R)-6,6-dimethyl-2-(2-methylprop-1-enyl)-2,4-diphenyl-1,5-dihydropyrimidine (PubChem CID 139065652) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2R)-6,6-dimethyl-2-(2-methylprop-1-enyl)-2,4-diphenyl-1,5-dihydropyrimidine.
| Compound Name | (2R)-6,6-dimethyl-2-(2-methylprop-1-enyl)-2,4-diphenyl-1,5-dihydropyrimidine |
|---|---|
| PubChem CID | 139065652 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (2R)-6,6-dimethyl-2-(2-methylprop-1-enyl)-2,4-diphenyl-1,5-dihydropyrimidine |
| SMILES | CC(C)=C[C@]1(c2ccccc2)N=C(c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H26N2/c1-17(2)15-22(19-13-9-6-10-14-19)23-20(16-21(3,4)24-22)18-11-7-5-8-12-18/h5-15,24H,16H2,1-4H3/t22-/m0/s1 |
| InChIKey | RXBIWGFXDHSIIV-QFIPXVFZSA-N |
| XLogP | 5.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|