C44H36Br4N4O4S2 — CID 139065703
N-[[1-(benzenesulfonyl)-3-bromoindol-2-yl]methyl]-2-bromo-4-methylaniline (PubChem CID 139065703) has the molecular formula C44H36Br4N4O4S2 and a molecular weight of 1068.55 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)-3-bromoindol-2-yl]methyl]-2-bromo-4-methylaniline.
| Compound Name | N-[[1-(benzenesulfonyl)-3-bromoindol-2-yl]methyl]-2-bromo-4-methylaniline |
|---|---|
| PubChem CID | 139065703 |
| Molecular Formula | C44H36Br4N4O4S2 |
| Molecular Weight | 1068.55 g/mol |
| Exact Mass | 1063.89 |
| IUPAC Name | N-[[1-(benzenesulfonyl)-3-bromoindol-2-yl]methyl]-2-bromo-4-methylaniline |
| SMILES | Cc1ccc(NCc2c(Br)c3ccccc3n2S(=O)(=O)c2ccccc2)c(Br)c1.Cc1ccc(NCc2c(Br)c3ccccc3n2S(=O)(=O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/2C22H18Br2N2O2S/c2*1-15-11-12-19(18(23)13-15)25-14-21-22(24)17-9-5-6-10-20(17)26(21)29(27,28)16-7-3-2-4-8-16/h2*2-13,25H,14H2,1H3 |
| InChIKey | KYKQTIGJGDNVIN-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1068.55 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |