C15H24N4O7 — CID 139066032
propan-2-yl (2R,4R,5S)-5-[[[(2R,4R,5S)-5-(azidomethyl)-4-hydroxyoxolane-2-carbonyl]amino]methyl]-4-hydroxyoxolane-2-carboxylate (PubChem CID 139066032) has the molecular formula C15H24N4O7 and a molecular weight of 372.38 g/mol. Its IUPAC name is propan-2-yl (2R,4R,5S)-5-[[[(2R,4R,5S)-5-(azidomethyl)-4-hydroxyoxolane-2-carbonyl]amino]methyl]-4-hydroxyoxolane-2-carboxylate.
| Compound Name | propan-2-yl (2R,4R,5S)-5-[[[(2R,4R,5S)-5-(azidomethyl)-4-hydroxyoxolane-2-carbonyl]amino]methyl]-4-hydroxyoxolane-2-carboxylate |
|---|---|
| PubChem CID | 139066032 |
| Molecular Formula | C15H24N4O7 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | propan-2-yl (2R,4R,5S)-5-[[[(2R,4R,5S)-5-(azidomethyl)-4-hydroxyoxolane-2-carbonyl]amino]methyl]-4-hydroxyoxolane-2-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1C[C@@H](O)[C@H](CNC(=O)[C@H]2C[C@@H](O)[C@H](CN=[N+]=[N-])O2)O1 |
| InChI | InChI=1S/C15H24N4O7/c1-7(2)24-15(23)11-4-9(21)12(26-11)5-17-14(22)10-3-8(20)13(25-10)6-18-19-16/h7-13,20-21H,3-6H2,1-2H3,(H,17,22)/t8-,9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | NMOAIYOAVWNTGH-PTEOKISQSA-N |
| XLogP | -0.60 |
| TPSA | 163.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|