C23H28N2O2 — CID 139066052
(4aS,9S,9aS)-4a-morpholin-4-yl-N-phenyl-1,2,3,4,9,9a-hexahydroxanthen-9-amine (PubChem CID 139066052) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (4aS,9S,9aS)-4a-morpholin-4-yl-N-phenyl-1,2,3,4,9,9a-hexahydroxanthen-9-amine.
| Compound Name | (4aS,9S,9aS)-4a-morpholin-4-yl-N-phenyl-1,2,3,4,9,9a-hexahydroxanthen-9-amine |
|---|---|
| PubChem CID | 139066052 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (4aS,9S,9aS)-4a-morpholin-4-yl-N-phenyl-1,2,3,4,9,9a-hexahydroxanthen-9-amine |
| SMILES | c1ccc(N[C@@H]2c3ccccc3O[C@@]3(N4CCOCC4)CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-2-8-18(9-3-1)24-22-19-10-4-5-12-21(19)27-23(13-7-6-11-20(22)23)25-14-16-26-17-15-25/h1-5,8-10,12,20,22,24H,6-7,11,13-17H2/t20-,22+,23-/m0/s1 |
| InChIKey | VEGDCMWLDQSFTR-WWNPGLIZSA-N |
| XLogP | 4.45 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |