C35H26Cl4N2O3 — CID 139066151
(1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one (PubChem CID 139066151) has the molecular formula C35H26Cl4N2O3 and a molecular weight of 664.42 g/mol. Its IUPAC name is (1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one.
| Compound Name | (1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one |
|---|---|
| PubChem CID | 139066151 |
| Molecular Formula | C35H26Cl4N2O3 |
| Molecular Weight | 664.42 g/mol |
| Exact Mass | 662.07 |
| IUPAC Name | (1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-diphenyl-4,8-dioxa-3,9-diazadispiro[4.1.47.45]pentadeca-2,9-dien-6-one |
| SMILES | O=C1[C@@]2(CCCC[C@@]13ON=C(c1c(Cl)cccc1Cl)[C@@H]3c1ccccc1)ON=C(c1c(Cl)cccc1Cl)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C35H26Cl4N2O3/c36-23-15-9-16-24(37)27(23)31-29(21-11-3-1-4-12-21)34(43-40-31)19-7-8-20-35(33(34)42)30(22-13-5-2-6-14-22)32(41-44-35)28-25(38)17-10-18-26(28)39/h1-6,9-18,29-30H,7-8,19-20H2/t29-,30-,34-,35-/m0/s1 |
| InChIKey | RNYWMSLIVJFBEA-JXWYWRPRSA-N |
| XLogP | 9.66 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.42 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |