C14H19BF2O3 — CID 139066298
(10R,12S)-6-ethoxy-4,4-difluoro-3-oxa-5-oxonia-4-boranuidatetracyclo[8.3.1.18,12.02,7]pentadeca-2(7),5-diene (PubChem CID 139066298) has the molecular formula C14H19BF2O3 and a molecular weight of 284.11 g/mol. Its IUPAC name is (10R,12S)-6-ethoxy-4,4-difluoro-3-oxa-5-oxonia-4-boranuidatetracyclo[8.3.1.18,12.02,7]pentadeca-2(7),5-diene.
| Compound Name | (10R,12S)-6-ethoxy-4,4-difluoro-3-oxa-5-oxonia-4-boranuidatetracyclo[8.3.1.18,12.02,7]pentadeca-2(7),5-diene |
|---|---|
| PubChem CID | 139066298 |
| Molecular Formula | C14H19BF2O3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (10R,12S)-6-ethoxy-4,4-difluoro-3-oxa-5-oxonia-4-boranuidatetracyclo[8.3.1.18,12.02,7]pentadeca-2(7),5-diene |
| SMILES | CCOC1=[O+][B-](F)(F)OC2=C1C1C[C@H]3CC2C[C@@H](C1)C3 |
| InChI | InChI=1S/C14H19BF2O3/c1-2-18-14-12-10-4-8-3-9(5-10)7-11(6-8)13(12)19-15(16,17)20-14/h8-11H,2-7H2,1H3/t8-,9+,10?,11? |
| InChIKey | DDRXZTBFLFJAFD-IXBNRNDTSA-N |
| XLogP | 3.20 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|