C48H90N6O15 — CID 139066302
ethyl (2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate (PubChem CID 139066302) has the molecular formula C48H90N6O15 and a molecular weight of 991.27 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 139066302 |
| Molecular Formula | C48H90N6O15 |
| Molecular Weight | 991.27 g/mol |
| Exact Mass | 990.65 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C.CCOC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C.CCOC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/3C16H30N2O5/c3*1-8-22-14(20)11(4)17-13(19)12(9-10(2)3)18-15(21)23-16(5,6)7/h3*10-12H,8-9H2,1-7H3,(H,17,19)(H,18,21)/t3*11-,12-/m000/s1 |
| InChIKey | RNZPCROLGHMJSL-AZRBBHAPSA-N |
| XLogP | 5.98 |
| TPSA | 281.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 69 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.27 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|