About CID 139066318
CID 139066318 (PubChem CID 139066318) has the molecular formula C22H20N4O2S
and a molecular weight of 404.50 g/mol.
Molecular Properties
| Compound Name | CID 139066318 |
| PubChem CID | 139066318 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccccc2)[C@]2(SC3=NCCN3C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H20N4O2S/c1-25-13-16(14-7-3-2-4-8-14)22(19(28)26-12-11-23-20(26)29-22)21(25)15-9-5-6-10-17(15)24-18(21)27/h2-10,16H,11-13H2,1H3,(H,24,27)/t16-,21+,22-/m1/s1 |
| InChIKey | HOQDSYIZYSLHTQ-URZJWIJPSA-N |
| XLogP | 2.25 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 139066318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139066318?
The IUPAC name of CID 139066318 (CID 139066318) is not available.
What is the SMILES notation for CID 139066318?
The canonical SMILES for CID 139066318 is CN1C[C@H](c2ccccc2)[C@]2(SC3=NCCN3C2=O)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 139066318?
The InChIKey is HOQDSYIZYSLHTQ-URZJWIJPSA-N. The full InChI is InChI=1S/C22H20N4O2S/c1-25-13-16(14-7-3-2-4-8-14)22(19(28)26-12-11-23-20(26)29-22)21(25)15-9-5-6-10-17(15)24-18(21)27/h2-10,16H,11-13H2,1H3,(H,24,27)/t16-,21+,22-/m1/s1.
What are the key properties of CID 139066318?
CID 139066318 has a molecular weight of 404.50 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139066318 is sourced from PubChem (CID 139066318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).