About CID 139066319
CID 139066319 (PubChem CID 139066319) has the molecular formula C56H46Cl2N8O6S2
and a molecular weight of 1062.07 g/mol.
Molecular Properties
| Compound Name | CID 139066319 |
| PubChem CID | 139066319 |
| Molecular Formula | C56H46Cl2N8O6S2 |
| Molecular Weight | 1062.07 g/mol |
| Exact Mass | 1060.24 |
| IUPAC Name | — |
| SMILES | C1COCCO1.CN1C[C@@H](c2ccccc2Cl)[C@@]2(Sc3nc4ccccc4n3C2=O)[C@@]12C(=O)Nc1ccccc12.CN1C[C@H](c2ccccc2Cl)[C@]2(Sc3nc4ccccc4n3C2=O)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/2C26H19ClN4O2S.C4H8O2/c2*1-30-14-17(15-8-2-4-10-18(15)27)26(25(30)16-9-3-5-11-19(16)28-22(25)32)23(33)31-21-13-7-6-12-20(21)29-24(31)34-26;1-2-6-4-3-5-1/h2*2-13,17H,14H2,1H3,(H,28,32);1-4H2/t2*17-,25+,26-;/m10./s1 |
| InChIKey | VYTLCGONBLBKEW-ORWCJCKRSA-N |
| XLogP | 9.54 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1062.07 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
Analyze CID 139066319 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139066319?
The IUPAC name of CID 139066319 (CID 139066319) is not available.
What is the SMILES notation for CID 139066319?
The canonical SMILES for CID 139066319 is C1COCCO1.CN1C[C@@H](c2ccccc2Cl)[C@@]2(Sc3nc4ccccc4n3C2=O)[C@@]12C(=O)Nc1ccccc12.CN1C[C@H](c2ccccc2Cl)[C@]2(Sc3nc4ccccc4n3C2=O)[C@]12C(=O)Nc1ccccc12.
What is the InChIKey of CID 139066319?
The InChIKey is VYTLCGONBLBKEW-ORWCJCKRSA-N. The full InChI is InChI=1S/2C26H19ClN4O2S.C4H8O2/c2*1-30-14-17(15-8-2-4-10-18(15)27)26(25(30)16-9-3-5-11-19(16)28-22(25)32)23(33)31-21-13-7-6-12-20(21)29-24(31)34-26;1-2-6-4-3-5-1/h2*2-13,17H,14H2,1H3,(H,28,32);1-4H2/t2*17-,25+,26-;/m10./s1.
What are the key properties of CID 139066319?
CID 139066319 has a molecular weight of 1062.07 g/mol, XLogP of 9.54, 2 rotatable bonds, 2 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139066319 is sourced from PubChem (CID 139066319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).