C17H20BF3NOP — CID 139066413
[(4S,5R)-3,4-dimethyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-oxazaphospholidin-2-ium-2-yl]boranuide (PubChem CID 139066413) has the molecular formula C17H20BF3NOP and a molecular weight of 353.13 g/mol. Its IUPAC name is [(4S,5R)-3,4-dimethyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-oxazaphospholidin-2-ium-2-yl]boranuide.
| Compound Name | [(4S,5R)-3,4-dimethyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-oxazaphospholidin-2-ium-2-yl]boranuide |
|---|---|
| PubChem CID | 139066413 |
| Molecular Formula | C17H20BF3NOP |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [(4S,5R)-3,4-dimethyl-5-phenyl-2-[4-(trifluoromethyl)phenyl]-1,3,2-oxazaphospholidin-2-ium-2-yl]boranuide |
| SMILES | [BH3-][P+]1(c2ccc(C(F)(F)F)cc2)O[C@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C17H20BF3NOP/c1-12-16(13-6-4-3-5-7-13)23-24(18,22(12)2)15-10-8-14(9-11-15)17(19,20)21/h3-12,16H,1-2,18H3/t12-,16-,24?/m0/s1 |
| InChIKey | LNCWEGOQCICCQE-IGBIWHMQSA-N |
| XLogP | 3.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|