C26H38N2O8 — CID 139066715
(1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one (PubChem CID 139066715) has the molecular formula C26H38N2O8 and a molecular weight of 506.60 g/mol. Its IUPAC name is (1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one.
| Compound Name | (1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one |
|---|---|
| PubChem CID | 139066715 |
| Molecular Formula | C26H38N2O8 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (1R,3S,9R,12S)-14,14-dimethyl-10,13,15-trioxa-7-azatetracyclo[7.6.0.01,12.03,7]pentadecan-6-one |
| SMILES | CC1(C)O[C@H]2CO[C@@H]3CN4C(=O)CC[C@H]4C[C@]23O1.CC1(C)O[C@H]2CO[C@@H]3CN4C(=O)CC[C@H]4C[C@]23O1 |
| InChI | InChI=1S/2C13H19NO4/c2*1-12(2)17-10-7-16-9-6-14-8(3-4-11(14)15)5-13(9,10)18-12/h2*8-10H,3-7H2,1-2H3/t2*8-,9+,10-,13+/m00/s1 |
| InChIKey | IWPGSISOLDWRAJ-AWIDDCPHSA-N |
| XLogP | 1.34 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |