About 4,5-diphenyl-1H-imidazole
4,5-diphenyl-1H-imidazole (PubChem CID 139066803) has the molecular formula C30H24N4
and a molecular weight of 440.55 g/mol. Its IUPAC name is 4,5-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 4,5-diphenyl-1H-imidazole |
| PubChem CID | 139066803 |
| Molecular Formula | C30H24N4 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4,5-diphenyl-1H-imidazole |
| SMILES | c1ccc(-c2nc[nH]c2-c2ccccc2)cc1.c1ccc(-c2nc[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/2C15H12N2/c2*1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h2*1-11H,(H,16,17) |
| InChIKey | MNNOZKGCWYQQSS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenyl-1H-imidazole?
The IUPAC name of 4,5-diphenyl-1H-imidazole (CID 139066803) is 4,5-diphenyl-1H-imidazole.
What is the SMILES notation for 4,5-diphenyl-1H-imidazole?
The canonical SMILES for 4,5-diphenyl-1H-imidazole is c1ccc(-c2nc[nH]c2-c2ccccc2)cc1.c1ccc(-c2nc[nH]c2-c2ccccc2)cc1.
What is the InChIKey of 4,5-diphenyl-1H-imidazole?
The InChIKey is MNNOZKGCWYQQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H12N2/c2*1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h2*1-11H,(H,16,17).
What are the key properties of 4,5-diphenyl-1H-imidazole?
4,5-diphenyl-1H-imidazole has a molecular weight of 440.55 g/mol, XLogP of 7.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenyl-1H-imidazole is sourced from PubChem (CID 139066803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).