About copper;bis(3-methylbenzoate);1,10-phenanthroline
copper;bis(3-methylbenzoate);1,10-phenanthroline (PubChem CID 139067105) has the molecular formula C28H22CuN2O4
and a molecular weight of 514.04 g/mol. Its IUPAC name is copper;bis(3-methylbenzoate);1,10-phenanthroline.
Molecular Properties
| Compound Name | copper;bis(3-methylbenzoate);1,10-phenanthroline |
| PubChem CID | 139067105 |
| Molecular Formula | C28H22CuN2O4 |
| Molecular Weight | 514.04 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | copper;bis(3-methylbenzoate);1,10-phenanthroline |
| SMILES | Cc1cccc(C(=O)[O-])c1.Cc1cccc(C(=O)[O-])c1.[Cu+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C8H8O2.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*1-6-3-2-4-7(5-6)8(9)10;/h1-8H;2*2-5H,1H3,(H,9,10);/q;;;+2/p-2 |
| InChIKey | RBBAIRRMZGFMOA-UHFFFAOYSA-L |
| XLogP | 3.50 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.04 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(3-methylbenzoate);1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(3-methylbenzoate);1,10-phenanthroline?
The IUPAC name of copper;bis(3-methylbenzoate);1,10-phenanthroline (CID 139067105) is copper;bis(3-methylbenzoate);1,10-phenanthroline.
What is the SMILES notation for copper;bis(3-methylbenzoate);1,10-phenanthroline?
The canonical SMILES for copper;bis(3-methylbenzoate);1,10-phenanthroline is Cc1cccc(C(=O)[O-])c1.Cc1cccc(C(=O)[O-])c1.[Cu+2].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of copper;bis(3-methylbenzoate);1,10-phenanthroline?
The InChIKey is RBBAIRRMZGFMOA-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2.2C8H8O2.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*1-6-3-2-4-7(5-6)8(9)10;/h1-8H;2*2-5H,1H3,(H,9,10);/q;;;+2/p-2.
What are the key properties of copper;bis(3-methylbenzoate);1,10-phenanthroline?
copper;bis(3-methylbenzoate);1,10-phenanthroline has a molecular weight of 514.04 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(3-methylbenzoate);1,10-phenanthroline is sourced from PubChem (CID 139067105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).