C9H16O4 — CID 139067140
(2R,3S,4S,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4-diol (PubChem CID 139067140) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (2R,3S,4S,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4-diol.
| Compound Name | (2R,3S,4S,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4-diol |
|---|---|
| PubChem CID | 139067140 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2R,3S,4S,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4-diol |
| SMILES | C=CC[C@@H]1C[C@H](O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C9H16O4/c1-2-3-6-4-7(11)9(12)8(5-10)13-6/h2,6-12H,1,3-5H2/t6-,7+,8-,9+/m1/s1 |
| InChIKey | RLRWHCQPHLHEQD-XAVMHZPKSA-N |
| XLogP | -0.57 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|