C23H28O2 — CID 139067294
(4bS,6aS,10aR,11aS,11bS)-2-methoxy-6a-methyl-5,6,9,10,10a,11,11a,11b,12,13-decahydro-4bH-indeno[2,1-a]phenanthren-8-one (PubChem CID 139067294) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (4bS,6aS,10aR,11aS,11bS)-2-methoxy-6a-methyl-5,6,9,10,10a,11,11a,11b,12,13-decahydro-4bH-indeno[2,1-a]phenanthren-8-one.
| Compound Name | (4bS,6aS,10aR,11aS,11bS)-2-methoxy-6a-methyl-5,6,9,10,10a,11,11a,11b,12,13-decahydro-4bH-indeno[2,1-a]phenanthren-8-one |
|---|---|
| PubChem CID | 139067294 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (4bS,6aS,10aR,11aS,11bS)-2-methoxy-6a-methyl-5,6,9,10,10a,11,11a,11b,12,13-decahydro-4bH-indeno[2,1-a]phenanthren-8-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C3=CC(=O)CC[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C23H28O2/c1-23-10-9-19-18-8-6-17(25-2)11-14(18)4-7-20(19)22(23)12-15-3-5-16(24)13-21(15)23/h6,8,11,13,15,19-20,22H,3-5,7,9-10,12H2,1-2H3/t15-,19-,20-,22+,23-/m1/s1 |
| InChIKey | CBLBHVWYKUOPAC-WCSRJGBQSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |