About (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one
(4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 139067403) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| PubChem CID | 139067403 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC(=O)C1=C(C)NC(=O)N[C@@H]1C |
| InChI | InChI=1S/C8H12N2O2/c1-4-7(6(3)11)5(2)10-8(12)9-4/h4H,1-3H3,(H2,9,10,12)/t4-/m1/s1 |
| InChIKey | YHPINGWPBONOBQ-SCSAIBSYSA-N |
| XLogP | 0.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one (CID 139067403) is (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one is CC(=O)C1=C(C)NC(=O)N[C@@H]1C.
What is the InChIKey of (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is YHPINGWPBONOBQ-SCSAIBSYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-4-7(6(3)11)5(2)10-8(12)9-4/h4H,1-3H3,(H2,9,10,12)/t4-/m1/s1.
What are the key properties of (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one?
(4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 168.20 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5-acetyl-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 139067403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).