About zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate
zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate (PubChem CID 139067441) has the molecular formula C17H13N3O4Zn
and a molecular weight of 388.70 g/mol. Its IUPAC name is zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate.
Molecular Properties
| Compound Name | zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate |
| PubChem CID | 139067441 |
| Molecular Formula | C17H13N3O4Zn |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate |
| SMILES | O=[N+]([O-])[O-].[O-]c1ccc2ccccc2c1/C=N/Cc1ccccn1.[Zn+2] |
| InChI | InChI=1S/C17H14N2O.NO3.Zn/c20-17-9-8-13-5-1-2-7-15(13)16(17)12-18-11-14-6-3-4-10-19-14;2-1(3)4;/h1-10,12,20H,11H2;;/q;-1;+2/p-1/b18-12+;; |
| InChIKey | PKOVHAMMAZWHIQ-JKXROLASSA-M |
| XLogP | 2.69 |
| TPSA | 114.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate?
The IUPAC name of zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate (CID 139067441) is zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate.
What is the SMILES notation for zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate?
The canonical SMILES for zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate is O=[N+]([O-])[O-].[O-]c1ccc2ccccc2c1/C=N/Cc1ccccn1.[Zn+2].
What is the InChIKey of zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate?
The InChIKey is PKOVHAMMAZWHIQ-JKXROLASSA-M. The full InChI is InChI=1S/C17H14N2O.NO3.Zn/c20-17-9-8-13-5-1-2-7-15(13)16(17)12-18-11-14-6-3-4-10-19-14;2-1(3)4;/h1-10,12,20H,11H2;;/q;-1;+2/p-1/b18-12+;;.
What are the key properties of zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate?
zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate has a molecular weight of 388.70 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1-(pyridin-2-ylmethyliminomethyl)naphthalen-2-olate;nitrate is sourced from PubChem (CID 139067441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).