About 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium
3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium (PubChem CID 139067464) has the molecular formula C19H14N2O6S
and a molecular weight of 398.40 g/mol. Its IUPAC name is 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium.
Molecular Properties
| Compound Name | 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium |
| PubChem CID | 139067464 |
| Molecular Formula | C19H14N2O6S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium |
| SMILES | O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C12H8N2.C7H6O6S/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-8H;1-3,8H,(H,9,10)(H,11,12,13) |
| InChIKey | OPARUZBQVHXXCM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium?
The IUPAC name of 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium (CID 139067464) is 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium.
What is the SMILES notation for 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium?
The canonical SMILES for 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium is O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.c1cnc2c(c1)ccc1ccc[nH+]c12.
What is the InChIKey of 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium?
The InChIKey is OPARUZBQVHXXCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C7H6O6S/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-8H;1-3,8H,(H,9,10)(H,11,12,13).
What are the key properties of 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium?
3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium has a molecular weight of 398.40 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carboxy-4-hydroxybenzenesulfonate;1,10-phenanthrolin-10-ium is sourced from PubChem (CID 139067464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).