C28H52Si4 — CID 139067952
trimethyl-[(5S,12S,14S,15S)-12,14,15-tris(trimethylsilyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),6,10-tetraenyl]silane (PubChem CID 139067952) has the molecular formula C28H52Si4 and a molecular weight of 501.07 g/mol. Its IUPAC name is trimethyl-[(5S,12S,14S,15S)-12,14,15-tris(trimethylsilyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),6,10-tetraenyl]silane.
| Compound Name | trimethyl-[(5S,12S,14S,15S)-12,14,15-tris(trimethylsilyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),6,10-tetraenyl]silane |
|---|---|
| PubChem CID | 139067952 |
| Molecular Formula | C28H52Si4 |
| Molecular Weight | 501.07 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | trimethyl-[(5S,12S,14S,15S)-12,14,15-tris(trimethylsilyl)-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4(16),6,10-tetraenyl]silane |
| SMILES | C[Si](C)(C)[C@H]1C=C2CCC3=C[C@H]([Si](C)(C)C)C(=C[C@@H]3[Si](C)(C)C)CCC1=C[C@@H]2[Si](C)(C)C |
| InChI | InChI=1S/C28H52Si4/c1-29(2,3)25-17-22-15-16-24-20-27(31(7,8)9)23(19-28(24)32(10,11)12)14-13-21(25)18-26(22)30(4,5)6/h17-20,25-28H,13-16H2,1-12H3/t25-,26-,27-,28-/m0/s1 |
| InChIKey | PLVPELOJOVMZRX-LJWNLINESA-N |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.07 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|