C32H24Br2N8O7 — CID 139067972
bis(N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide);hydrate (PubChem CID 139067972) has the molecular formula C32H24Br2N8O7 and a molecular weight of 792.40 g/mol. Its IUPAC name is bis(N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide);hydrate.
| Compound Name | bis(N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide);hydrate |
|---|---|
| PubChem CID | 139067972 |
| Molecular Formula | C32H24Br2N8O7 |
| Molecular Weight | 792.40 g/mol |
| Exact Mass | 790.01 |
| IUPAC Name | bis(N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-2-nitrobenzamide);hydrate |
| SMILES | O.O=C(N/N=C/c1c[nH]c2ccc(Br)cc12)c1ccccc1[N+](=O)[O-].O=C(N/N=C/c1c[nH]c2ccc(Br)cc12)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/2C16H11BrN4O3.H2O/c2*17-11-5-6-14-13(7-11)10(8-18-14)9-19-20-16(22)12-3-1-2-4-15(12)21(23)24;/h2*1-9,18H,(H,20,22);1H2/b2*19-9+; |
| InChIKey | YKLQMFCTTXZUPS-QHQAJOGDSA-N |
| XLogP | 6.38 |
| TPSA | 232.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.40 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|