C22H20BrNO — CID 139068103
9-(4-bromophenyl)-3,3,7-trimethyl-2,4-dihydroacridin-1-one (PubChem CID 139068103) has the molecular formula C22H20BrNO and a molecular weight of 394.31 g/mol. Its IUPAC name is 9-(4-bromophenyl)-3,3,7-trimethyl-2,4-dihydroacridin-1-one.
| Compound Name | 9-(4-bromophenyl)-3,3,7-trimethyl-2,4-dihydroacridin-1-one |
|---|---|
| PubChem CID | 139068103 |
| Molecular Formula | C22H20BrNO |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 9-(4-bromophenyl)-3,3,7-trimethyl-2,4-dihydroacridin-1-one |
| SMILES | Cc1ccc2nc3c(c(-c4ccc(Br)cc4)c2c1)C(=O)CC(C)(C)C3 |
| InChI | InChI=1S/C22H20BrNO/c1-13-4-9-17-16(10-13)20(14-5-7-15(23)8-6-14)21-18(24-17)11-22(2,3)12-19(21)25/h4-10H,11-12H2,1-3H3 |
| InChIKey | CIUQDIGAGQIWKL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |