C46H44Cl2N2O2 — CID 139068321
1-[(4-chlorophenyl)methyl]-6,6-dimethyl-2-phenyl-5,7-dihydroindol-4-one (PubChem CID 139068321) has the molecular formula C46H44Cl2N2O2 and a molecular weight of 727.78 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6,6-dimethyl-2-phenyl-5,7-dihydroindol-4-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6,6-dimethyl-2-phenyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 139068321 |
| Molecular Formula | C46H44Cl2N2O2 |
| Molecular Weight | 727.78 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6,6-dimethyl-2-phenyl-5,7-dihydroindol-4-one |
| SMILES | CC1(C)CC(=O)c2cc(-c3ccccc3)n(Cc3ccc(Cl)cc3)c2C1.CC1(C)CC(=O)c2cc(-c3ccccc3)n(Cc3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/2C23H22ClNO/c2*1-23(2)13-21-19(22(26)14-23)12-20(17-6-4-3-5-7-17)25(21)15-16-8-10-18(24)11-9-16/h2*3-12H,13-15H2,1-2H3 |
| InChIKey | LINSGYBSHLMMAW-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.78 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |