C17H19N3O3 — CID 139068504
N,N-dimethylformamide;N-[(E)-(4-hydroxyphenyl)methylideneamino]benzamide (PubChem CID 139068504) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N,N-dimethylformamide;N-[(E)-(4-hydroxyphenyl)methylideneamino]benzamide.
| Compound Name | N,N-dimethylformamide;N-[(E)-(4-hydroxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 139068504 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N,N-dimethylformamide;N-[(E)-(4-hydroxyphenyl)methylideneamino]benzamide |
| SMILES | CN(C)C=O.O=C(N/N=C/c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2.C3H7NO/c17-13-8-6-11(7-9-13)10-15-16-14(18)12-4-2-1-3-5-12;1-4(2)3-5/h1-10,17H,(H,16,18);3H,1-2H3/b15-10+; |
| InChIKey | VBSONOLRYJTXFD-GYVLLFFHSA-N |
| XLogP | 1.86 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|