C30H18CoN2O12 — CID 139068596
cobalt(2+);bis(3,5-dicarboxybenzoate);1,10-phenanthroline (PubChem CID 139068596) has the molecular formula C30H18CoN2O12 and a molecular weight of 657.41 g/mol. Its IUPAC name is cobalt(2+);bis(3,5-dicarboxybenzoate);1,10-phenanthroline.
| Compound Name | cobalt(2+);bis(3,5-dicarboxybenzoate);1,10-phenanthroline |
|---|---|
| PubChem CID | 139068596 |
| Molecular Formula | C30H18CoN2O12 |
| Molecular Weight | 657.41 g/mol |
| Exact Mass | 657.02 |
| IUPAC Name | cobalt(2+);bis(3,5-dicarboxybenzoate);1,10-phenanthroline |
| SMILES | O=C([O-])c1cc(C(=O)O)cc(C(=O)O)c1.O=C([O-])c1cc(C(=O)O)cc(C(=O)O)c1.[Co+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C9H6O6.Co/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;/h1-8H;2*1-3H,(H,10,11)(H,12,13)(H,14,15);/q;;;+2/p-2 |
| InChIKey | NPFZIPCLZLXEBR-UHFFFAOYSA-L |
| XLogP | 1.67 |
| TPSA | 255.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|