C20H22N4O2 — CID 139068698
3-[[(1S,2S)-2-(2-cyanoethylamino)-1,2-bis(2-hydroxyphenyl)ethyl]amino]propanenitrile (PubChem CID 139068698) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[[(1S,2S)-2-(2-cyanoethylamino)-1,2-bis(2-hydroxyphenyl)ethyl]amino]propanenitrile.
| Compound Name | 3-[[(1S,2S)-2-(2-cyanoethylamino)-1,2-bis(2-hydroxyphenyl)ethyl]amino]propanenitrile |
|---|---|
| PubChem CID | 139068698 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-[[(1S,2S)-2-(2-cyanoethylamino)-1,2-bis(2-hydroxyphenyl)ethyl]amino]propanenitrile |
| SMILES | N#CCCN[C@@H](c1ccccc1O)[C@@H](NCCC#N)c1ccccc1O |
| InChI | InChI=1S/C20H22N4O2/c21-11-5-13-23-19(15-7-1-3-9-17(15)25)20(24-14-6-12-22)16-8-2-4-10-18(16)26/h1-4,7-10,19-20,23-26H,5-6,13-14H2/t19-,20-/m0/s1 |
| InChIKey | KTPFODCMHUODPY-PMACEKPBSA-N |
| XLogP | 2.89 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|