C16H19N2O3P — CID 139068772
N-[(2S,4S)-5,5-dimethyl-2-oxo-4-phenyl-1,3,2λ5-dioxaphosphinan-2-yl]pyridin-2-amine (PubChem CID 139068772) has the molecular formula C16H19N2O3P and a molecular weight of 318.31 g/mol. Its IUPAC name is N-[(2S,4S)-5,5-dimethyl-2-oxo-4-phenyl-1,3,2λ5-dioxaphosphinan-2-yl]pyridin-2-amine.
| Compound Name | N-[(2S,4S)-5,5-dimethyl-2-oxo-4-phenyl-1,3,2λ5-dioxaphosphinan-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 139068772 |
| Molecular Formula | C16H19N2O3P |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-[(2S,4S)-5,5-dimethyl-2-oxo-4-phenyl-1,3,2λ5-dioxaphosphinan-2-yl]pyridin-2-amine |
| SMILES | CC1(C)CO[P@@](=O)(Nc2ccccn2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H19N2O3P/c1-16(2)12-20-22(19,18-14-10-6-7-11-17-14)21-15(16)13-8-4-3-5-9-13/h3-11,15H,12H2,1-2H3,(H,17,18,19)/t15-,22-/m0/s1 |
| InChIKey | CMEKIZOMCTUGKC-NYHFZMIOSA-N |
| XLogP | 4.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|